C19H11F4NO3S — CID 67052333
4-[(4-fluorobenzoyl)amino]-2-[4-(trifluoromethyl)phenyl]thiophene-3-carboxylic acid (PubChem CID 67052333) has the molecular formula C19H11F4NO3S and a molecular weight of 409.36 g/mol. Its IUPAC name is 4-[(4-fluorobenzoyl)amino]-2-[4-(trifluoromethyl)phenyl]thiophene-3-carboxylic acid.
| Compound Name | 4-[(4-fluorobenzoyl)amino]-2-[4-(trifluoromethyl)phenyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 67052333 |
| Molecular Formula | C19H11F4NO3S |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 4-[(4-fluorobenzoyl)amino]-2-[4-(trifluoromethyl)phenyl]thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1csc(-c2ccc(C(F)(F)F)cc2)c1C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H11F4NO3S/c20-13-7-3-11(4-8-13)17(25)24-14-9-28-16(15(14)18(26)27)10-1-5-12(6-2-10)19(21,22)23/h1-9H,(H,24,25)(H,26,27) |
| InChIKey | UUWPFAAEQUSVNU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |