C18H12BrN3O3S2 — CID 123854717
2-(4-bromophenyl)-4-(2,3-dihydro-1,2,3-benzothiadiazole-5-carbonylamino)thiophene-3-carboxylic acid (PubChem CID 123854717) has the molecular formula C18H12BrN3O3S2 and a molecular weight of 462.35 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-(2,3-dihydro-1,2,3-benzothiadiazole-5-carbonylamino)thiophene-3-carboxylic acid.
| Compound Name | 2-(4-bromophenyl)-4-(2,3-dihydro-1,2,3-benzothiadiazole-5-carbonylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 123854717 |
| Molecular Formula | C18H12BrN3O3S2 |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 460.95 |
| IUPAC Name | 2-(4-bromophenyl)-4-(2,3-dihydro-1,2,3-benzothiadiazole-5-carbonylamino)thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1csc(-c2ccc(Br)cc2)c1C(=O)O)c1ccc2c(c1)NNS2 |
| InChI | InChI=1S/C18H12BrN3O3S2/c19-11-4-1-9(2-5-11)16-15(18(24)25)13(8-26-16)20-17(23)10-3-6-14-12(7-10)21-22-27-14/h1-8,21-22H,(H,20,23)(H,24,25) |
| InChIKey | XKHUANLHJDKTDQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|