C18H13BrN2O3S — CID 58191184
2-(4-bromophenyl)-4-[(6-methylpyridine-3-carbonyl)amino]thiophene-3-carboxylic acid (PubChem CID 58191184) has the molecular formula C18H13BrN2O3S and a molecular weight of 417.28 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-[(6-methylpyridine-3-carbonyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 2-(4-bromophenyl)-4-[(6-methylpyridine-3-carbonyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58191184 |
| Molecular Formula | C18H13BrN2O3S |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | 2-(4-bromophenyl)-4-[(6-methylpyridine-3-carbonyl)amino]thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(C(=O)Nc2csc(-c3ccc(Br)cc3)c2C(=O)O)cn1 |
| InChI | InChI=1S/C18H13BrN2O3S/c1-10-2-3-12(8-20-10)17(22)21-14-9-25-16(15(14)18(23)24)11-4-6-13(19)7-5-11/h2-9H,1H3,(H,21,22)(H,23,24) |
| InChIKey | YAXDNFZLTVBXNR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |