C19H16BFNO3 — CID 123933845
CID 123933845 (PubChem CID 123933845) has the molecular formula C19H16BFNO3 and a molecular weight of 336.15 g/mol.
| Compound Name | CID 123933845 |
|---|---|
| PubChem CID | 123933845 |
| Molecular Formula | C19H16BFNO3 |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | — |
| SMILES | O=C[B]N1C(=O)C(C=O)C[C@H]1Cc1ccc(-c2ccccc2F)cc1 |
| InChI | InChI=1S/C19H16BFNO3/c21-18-4-2-1-3-17(18)14-7-5-13(6-8-14)9-16-10-15(11-23)19(25)22(16)20-12-24/h1-8,11-12,15-16H,9-10H2/t15?,16-/m1/s1 |
| InChIKey | XUXOPALGFSGQLI-OEMAIJDKSA-N |
| XLogP | 2.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|