C19H20BNO3 — CID 123485872
[(5S)-3-formyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidin-1-yl]-methylborinic acid (PubChem CID 123485872) has the molecular formula C19H20BNO3 and a molecular weight of 321.19 g/mol. Its IUPAC name is [(5S)-3-formyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidin-1-yl]-methylborinic acid.
| Compound Name | [(5S)-3-formyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 123485872 |
| Molecular Formula | C19H20BNO3 |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | [(5S)-3-formyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1C(=O)C(C=O)C[C@H]1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20BNO3/c1-20(24)21-18(12-17(13-22)19(21)23)11-14-7-9-16(10-8-14)15-5-3-2-4-6-15/h2-10,13,17-18,24H,11-12H2,1H3/t17?,18-/m1/s1 |
| InChIKey | HZPSJHOLFPJDAH-QRWMCTBCSA-N |
| XLogP | 2.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|