C32H27NO2 — CID 67326426
3-benzoyl-1-[(E)-2-phenylethenyl]-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one (PubChem CID 67326426) has the molecular formula C32H27NO2 and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-benzoyl-1-[(E)-2-phenylethenyl]-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 3-benzoyl-1-[(E)-2-phenylethenyl]-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 67326426 |
| Molecular Formula | C32H27NO2 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 3-benzoyl-1-[(E)-2-phenylethenyl]-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one |
| SMILES | O=C(c1ccccc1)C1CC(Cc2ccc(-c3ccccc3)cc2)N(/C=C/c2ccccc2)C1=O |
| InChI | InChI=1S/C32H27NO2/c34-31(28-14-8-3-9-15-28)30-23-29(33(32(30)35)21-20-24-10-4-1-5-11-24)22-25-16-18-27(19-17-25)26-12-6-2-7-13-26/h1-21,29-30H,22-23H2/b21-20+ |
| InChIKey | YAABCEKGUQXKDB-QZQOTICOSA-N |
| XLogP | 6.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|