C20H18O — CID 134887905
phenyl-[2-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclopropyl]methanone (PubChem CID 134887905) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is phenyl-[2-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclopropyl]methanone.
| Compound Name | phenyl-[2-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclopropyl]methanone |
|---|---|
| PubChem CID | 134887905 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | phenyl-[2-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclopropyl]methanone |
| SMILES | O=C(c1ccccc1)C1CC1/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H18O/c21-20(17-12-5-2-6-13-17)19-15-18(19)14-8-7-11-16-9-3-1-4-10-16/h1-14,18-19H,15H2/b11-7+,14-8+ |
| InChIKey | ONEGOADQRWJYJN-HPIZBCMHSA-N |
| XLogP | 4.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|