C21H20O2 — CID 135063555
(1R,2R,3R)-3-benzoyl-2-[(E)-2-phenylethenyl]cyclopentane-1-carbaldehyde (PubChem CID 135063555) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (1R,2R,3R)-3-benzoyl-2-[(E)-2-phenylethenyl]cyclopentane-1-carbaldehyde.
| Compound Name | (1R,2R,3R)-3-benzoyl-2-[(E)-2-phenylethenyl]cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 135063555 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1R,2R,3R)-3-benzoyl-2-[(E)-2-phenylethenyl]cyclopentane-1-carbaldehyde |
| SMILES | O=C[C@@H]1CC[C@@H](C(=O)c2ccccc2)[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H20O2/c22-15-18-12-14-20(21(23)17-9-5-2-6-10-17)19(18)13-11-16-7-3-1-4-8-16/h1-11,13,15,18-20H,12,14H2/b13-11+/t18-,19+,20+/m0/s1 |
| InChIKey | ORTGLYPXJGQNJI-XHWSNEKPSA-N |
| XLogP | 4.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|