C20H26N8O2 — CID 123937234
3-(4-methoxyhepta-2,4-dienyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine (PubChem CID 123937234) has the molecular formula C20H26N8O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-(4-methoxyhepta-2,4-dienyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine.
| Compound Name | 3-(4-methoxyhepta-2,4-dienyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 123937234 |
| Molecular Formula | C20H26N8O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 3-(4-methoxyhepta-2,4-dienyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine |
| SMILES | CCC=C(C=CCn1nnc2cnc(Nc3cnn(C4CCOCC4)c3)nc21)OC |
| InChI | InChI=1S/C20H26N8O2/c1-3-5-17(29-2)6-4-9-27-19-18(25-26-27)13-21-20(24-19)23-15-12-22-28(14-15)16-7-10-30-11-8-16/h4-6,12-14,16H,3,7-11H2,1-2H3,(H,21,23,24) |
| InChIKey | GDHYABXICZZZEA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 104.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|