C22H27ClN8O — CID 90389866
N-[1-(4-aminocyclohexyl)pyrazol-4-yl]-9-(4-ethoxyphenyl)purin-2-amine;hydrochloride (PubChem CID 90389866) has the molecular formula C22H27ClN8O and a molecular weight of 454.97 g/mol. Its IUPAC name is N-[1-(4-aminocyclohexyl)pyrazol-4-yl]-9-(4-ethoxyphenyl)purin-2-amine;hydrochloride.
| Compound Name | N-[1-(4-aminocyclohexyl)pyrazol-4-yl]-9-(4-ethoxyphenyl)purin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 90389866 |
| Molecular Formula | C22H27ClN8O |
| Molecular Weight | 454.97 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-[1-(4-aminocyclohexyl)pyrazol-4-yl]-9-(4-ethoxyphenyl)purin-2-amine;hydrochloride |
| SMILES | CCOc1ccc(-n2cnc3cnc(Nc4cnn(C5CCC(N)CC5)c4)nc32)cc1.Cl |
| InChI | InChI=1S/C22H26N8O.ClH/c1-2-31-19-9-7-17(8-10-19)29-14-25-20-12-24-22(28-21(20)29)27-16-11-26-30(13-16)18-5-3-15(23)4-6-18;/h7-15,18H,2-6,23H2,1H3,(H,24,27,28);1H |
| InChIKey | ALXJQFJYSDRMIA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.97 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |