C11H14FN3O4S — CID 123937396
3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 123937396) has the molecular formula C11H14FN3O4S and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 123937396 |
| Molecular Formula | C11H14FN3O4S |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | OCC1OC(N2C=C3C=C(F)NC3NC2=S)C(O)C1O |
| InChI | InChI=1S/C11H14FN3O4S/c12-6-1-4-2-15(11(20)14-9(4)13-6)10-8(18)7(17)5(3-16)19-10/h1-2,5,7-10,13,16-18H,3H2,(H,14,20) |
| InChIKey | FNYCYJQCAJZJLO-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|