C20H31NO2 — CID 123938451
(8R,9S,10S,13S,14S)-7-methoxyimino-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 123938451) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-7-methoxyimino-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10S,13S,14S)-7-methoxyimino-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 123938451 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (8R,9S,10S,13S,14S)-7-methoxyimino-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CON=C1CC2CCCC[C@]2(C)[C@H]2CC[C@]3(C)C(=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C20H31NO2/c1-19-10-5-4-6-13(19)12-16(21-23-3)18-14-7-8-17(22)20(14,2)11-9-15(18)19/h13-15,18H,4-12H2,1-3H3/t13?,14-,15-,18-,19-,20-/m0/s1 |
| InChIKey | WTURGPWTYUZMTL-ZRKWBTFWSA-N |
| XLogP | 4.60 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|