C54H33N5 — CID 123940722
3-isocyano-5-[3-(N-naphthalen-1-ylanilino)phenyl]-11,12-diphenylindolo[2,3-a]carbazole-8-carbonitrile (PubChem CID 123940722) has the molecular formula C54H33N5 and a molecular weight of 751.89 g/mol. Its IUPAC name is 3-isocyano-5-[3-(N-naphthalen-1-ylanilino)phenyl]-11,12-diphenylindolo[2,3-a]carbazole-8-carbonitrile.
| Compound Name | 3-isocyano-5-[3-(N-naphthalen-1-ylanilino)phenyl]-11,12-diphenylindolo[2,3-a]carbazole-8-carbonitrile |
|---|---|
| PubChem CID | 123940722 |
| Molecular Formula | C54H33N5 |
| Molecular Weight | 751.89 g/mol |
| Exact Mass | 751.27 |
| IUPAC Name | 3-isocyano-5-[3-(N-naphthalen-1-ylanilino)phenyl]-11,12-diphenylindolo[2,3-a]carbazole-8-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1c(-c3cccc(N(c4ccccc4)c4cccc5ccccc45)c3)cc3c4cc(C#N)ccc4n(-c4ccccc4)c3c1n2-c1ccccc1 |
| InChI | InChI=1S/C54H33N5/c1-56-39-28-30-51-48(33-39)52-45(38-17-13-24-43(32-38)57(40-18-5-2-6-19-40)49-26-14-16-37-15-11-12-25-44(37)49)34-47-46-31-36(35-55)27-29-50(46)58(41-20-7-3-8-21-41)53(47)54(52)59(51)42-22-9-4-10-23-42/h2-34H |
| InChIKey | KQOLWTWCQHAPRA-UHFFFAOYSA-N |
| XLogP | 14.59 |
| TPSA | 41.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.89 |
| LogP ≤ 5 | 14.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|