C60H38N6 — CID 140803084
3-[[2-(3-isocyano-N-naphthalen-1-ylanilino)-5,10-diphenylindolo[3,2-b]indol-7-yl]-naphthalen-1-ylamino]benzonitrile (PubChem CID 140803084) has the molecular formula C60H38N6 and a molecular weight of 843.01 g/mol. Its IUPAC name is 3-[[2-(3-isocyano-N-naphthalen-1-ylanilino)-5,10-diphenylindolo[3,2-b]indol-7-yl]-naphthalen-1-ylamino]benzonitrile.
| Compound Name | 3-[[2-(3-isocyano-N-naphthalen-1-ylanilino)-5,10-diphenylindolo[3,2-b]indol-7-yl]-naphthalen-1-ylamino]benzonitrile |
|---|---|
| PubChem CID | 140803084 |
| Molecular Formula | C60H38N6 |
| Molecular Weight | 843.01 g/mol |
| Exact Mass | 842.32 |
| IUPAC Name | 3-[[2-(3-isocyano-N-naphthalen-1-ylanilino)-5,10-diphenylindolo[3,2-b]indol-7-yl]-naphthalen-1-ylamino]benzonitrile |
| SMILES | [C-]#[N+]c1cccc(N(c2ccc3c(c2)n(-c2ccccc2)c2c4ccc(N(c5cccc(C#N)c5)c5cccc6ccccc56)cc4n(-c4ccccc4)c32)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C60H38N6/c1-62-44-21-15-27-48(37-44)64(56-31-14-20-43-18-9-11-29-52(43)56)50-33-35-54-58(39-50)66(46-24-6-3-7-25-46)59-53-34-32-49(38-57(53)65(60(54)59)45-22-4-2-5-23-45)63(47-26-12-16-41(36-47)40-61)55-30-13-19-42-17-8-10-28-51(42)55/h2-39H |
| InChIKey | KUXOGNBCQFZZJR-UHFFFAOYSA-N |
| XLogP | 16.40 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.01 |
| LogP ≤ 5 | 16.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|