C46H27F2N5 — CID 140638985
3-(4-fluoro-N-[10-(4-fluoro-N-(3-isocyanophenyl)anilino)-15-phenyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaen-3-yl]anilino)benzonitrile (PubChem CID 140638985) has the molecular formula C46H27F2N5 and a molecular weight of 687.75 g/mol. Its IUPAC name is 3-(4-fluoro-N-[10-(4-fluoro-N-(3-isocyanophenyl)anilino)-15-phenyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaen-3-yl]anilino)benzonitrile.
| Compound Name | 3-(4-fluoro-N-[10-(4-fluoro-N-(3-isocyanophenyl)anilino)-15-phenyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaen-3-yl]anilino)benzonitrile |
|---|---|
| PubChem CID | 140638985 |
| Molecular Formula | C46H27F2N5 |
| Molecular Weight | 687.75 g/mol |
| Exact Mass | 687.22 |
| IUPAC Name | 3-(4-fluoro-N-[10-(4-fluoro-N-(3-isocyanophenyl)anilino)-15-phenyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaen-3-yl]anilino)benzonitrile |
| SMILES | [C-]#[N+]c1cccc(N(c2ccc(F)cc2)c2cc3ccc4cc(N(c5ccc(F)cc5)c5cccc(C#N)c5)cc5c4c3c(c2)n5-c2ccccc2)c1 |
| InChI | InChI=1S/C46H27F2N5/c1-50-35-8-6-12-40(26-35)52(38-21-17-34(48)18-22-38)42-25-32-14-13-31-24-41(27-43-45(31)46(32)44(28-42)53(43)36-9-3-2-4-10-36)51(37-19-15-33(47)16-20-37)39-11-5-7-30(23-39)29-49/h2-28H |
| InChIKey | UBAFMRPYDJNDLR-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 39.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.75 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|