About 3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine
3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine (PubChem CID 123942194) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine.
Analyze 3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine?
The IUPAC name of 3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine (CID 123942194) is 3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine.
What is the SMILES notation for 3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine?
The canonical SMILES for 3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine is CC1=CC2C(C)C=NN2C=C1.
What is the InChIKey of 3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine?
The InChIKey is SZRSJIMTTZMYOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-7-3-4-11-9(5-7)8(2)6-10-11/h3-6,8-9H,1-2H3.
What are the key properties of 3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine?
3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine has a molecular weight of 148.21 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-3,3a-dihydropyrazolo[1,5-a]pyridine is sourced from PubChem (CID 123942194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).