C12H16FN3 — CID 123942235
2-(5-fluorohexa-2,4-dien-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine (PubChem CID 123942235) has the molecular formula C12H16FN3 and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-(5-fluorohexa-2,4-dien-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine.
| Compound Name | 2-(5-fluorohexa-2,4-dien-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 123942235 |
| Molecular Formula | C12H16FN3 |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 2-(5-fluorohexa-2,4-dien-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine |
| SMILES | CC(F)=CC=C(C)c1cn2c(n1)CNCC2 |
| InChI | InChI=1S/C12H16FN3/c1-9(3-4-10(2)13)11-8-16-6-5-14-7-12(16)15-11/h3-4,8,14H,5-7H2,1-2H3 |
| InChIKey | QACFGQZITWLXLY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|