C33H43F3N2O4 — CID 123943243
18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-N-(2,2,2-trifluoroethyl)-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-ene-5-carboxamide (PubChem CID 123943243) has the molecular formula C33H43F3N2O4 and a molecular weight of 588.71 g/mol. Its IUPAC name is 18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-N-(2,2,2-trifluoroethyl)-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-ene-5-carboxamide.
| Compound Name | 18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-N-(2,2,2-trifluoroethyl)-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-ene-5-carboxamide |
|---|---|
| PubChem CID | 123943243 |
| Molecular Formula | C33H43F3N2O4 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.32 |
| IUPAC Name | 18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-N-(2,2,2-trifluoroethyl)-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-ene-5-carboxamide |
| SMILES | CC1(C)CCC2(C(=O)NCC(F)(F)F)CCC3(C)C(C(=O)C=C4C5(C)C(CCC43C)C(C)(C)C(=O)C3(C#N)OC35)C2C1 |
| InChI | InChI=1S/C33H43F3N2O4/c1-26(2)10-12-31(25(41)38-17-33(34,35)36)13-11-29(6)22(18(31)15-26)19(39)14-21-28(29,5)9-8-20-27(3,4)23(40)32(16-37)24(42-32)30(20,21)7/h14,18,20,22,24H,8-13,15,17H2,1-7H3,(H,38,41) |
| InChIKey | AXSJSPMXGUMKEM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|