C15H23N3O5 — CID 123943559
acetic acid;(4S)-10-methylidene-6-oxo-N-(2-oxoethyl)-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide (PubChem CID 123943559) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is acetic acid;(4S)-10-methylidene-6-oxo-N-(2-oxoethyl)-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide.
| Compound Name | acetic acid;(4S)-10-methylidene-6-oxo-N-(2-oxoethyl)-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
|---|---|
| PubChem CID | 123943559 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | acetic acid;(4S)-10-methylidene-6-oxo-N-(2-oxoethyl)-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
| SMILES | C=C1CCCC(=O)N2[C@H](C(=O)NCC=O)CCCN12.CC(=O)O |
| InChI | InChI=1S/C13H19N3O3.C2H4O2/c1-10-4-2-6-12(18)16-11(5-3-8-15(10)16)13(19)14-7-9-17;1-2(3)4/h9,11H,1-8H2,(H,14,19);1H3,(H,3,4)/t11-;/m0./s1 |
| InChIKey | GMZJYMVAIDPREB-MERQFXBCSA-N |
| XLogP | 0.30 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|