C14H25N3O — CID 59033215
(4R,7S)-4-methyl-10-methylidene-7-(propan-2-ylamino)-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-6-one (PubChem CID 59033215) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is (4R,7S)-4-methyl-10-methylidene-7-(propan-2-ylamino)-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-6-one.
| Compound Name | (4R,7S)-4-methyl-10-methylidene-7-(propan-2-ylamino)-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-6-one |
|---|---|
| PubChem CID | 59033215 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | (4R,7S)-4-methyl-10-methylidene-7-(propan-2-ylamino)-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-6-one |
| SMILES | C=C1CC[C@H](NC(C)C)C(=O)N2[C@H](C)CCCN12 |
| InChI | InChI=1S/C14H25N3O/c1-10(2)15-13-8-7-11(3)16-9-5-6-12(4)17(16)14(13)18/h10,12-13,15H,3,5-9H2,1-2,4H3/t12-,13+/m1/s1 |
| InChIKey | IPVFERJGSXPDBJ-OLZOCXBDSA-N |
| XLogP | 1.89 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |