C11H20N2O — CID 89268209
3-(methylamino)-7-methylidene-1-propan-2-ylazepan-2-one (PubChem CID 89268209) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-(methylamino)-7-methylidene-1-propan-2-ylazepan-2-one.
| Compound Name | 3-(methylamino)-7-methylidene-1-propan-2-ylazepan-2-one |
|---|---|
| PubChem CID | 89268209 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3-(methylamino)-7-methylidene-1-propan-2-ylazepan-2-one |
| SMILES | C=C1CCCC(NC)C(=O)N1C(C)C |
| InChI | InChI=1S/C11H20N2O/c1-8(2)13-9(3)6-5-7-10(12-4)11(13)14/h8,10,12H,3,5-7H2,1-2,4H3 |
| InChIKey | XPCBUCZPKKQVMD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |