C20H43N2O5+ — CID 123944114
3-[[3-[2-[1-hydroxy-3-(hydroxymethyl)pentan-2-yl]oxybutoxy]-2-methylpropanoyl]amino]propyl-trimethylazanium (PubChem CID 123944114) has the molecular formula C20H43N2O5+ and a molecular weight of 391.57 g/mol. Its IUPAC name is 3-[[3-[2-[1-hydroxy-3-(hydroxymethyl)pentan-2-yl]oxybutoxy]-2-methylpropanoyl]amino]propyl-trimethylazanium.
| Compound Name | 3-[[3-[2-[1-hydroxy-3-(hydroxymethyl)pentan-2-yl]oxybutoxy]-2-methylpropanoyl]amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 123944114 |
| Molecular Formula | C20H43N2O5+ |
| Molecular Weight | 391.57 g/mol |
| Exact Mass | 391.32 |
| IUPAC Name | 3-[[3-[2-[1-hydroxy-3-(hydroxymethyl)pentan-2-yl]oxybutoxy]-2-methylpropanoyl]amino]propyl-trimethylazanium |
| SMILES | CCC(COCC(C)C(=O)NCCC[N+](C)(C)C)OC(CO)C(CC)CO |
| InChI | InChI=1S/C20H42N2O5/c1-7-17(12-23)19(13-24)27-18(8-2)15-26-14-16(3)20(25)21-10-9-11-22(4,5)6/h16-19,23-24H,7-15H2,1-6H3/p+1 |
| InChIKey | JPEQHQGXFASSIQ-UHFFFAOYSA-O |
| XLogP | 1.03 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.57 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|