C52H37N4O+ — CID 123944529
5-[2'-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9'-spirobi[fluorene]-2-yl]-1-ethyl-8-methoxyquinolin-1-ium (PubChem CID 123944529) has the molecular formula C52H37N4O+ and a molecular weight of 733.90 g/mol. Its IUPAC name is 5-[2'-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9'-spirobi[fluorene]-2-yl]-1-ethyl-8-methoxyquinolin-1-ium.
| Compound Name | 5-[2'-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9'-spirobi[fluorene]-2-yl]-1-ethyl-8-methoxyquinolin-1-ium |
|---|---|
| PubChem CID | 123944529 |
| Molecular Formula | C52H37N4O+ |
| Molecular Weight | 733.90 g/mol |
| Exact Mass | 733.30 |
| IUPAC Name | 5-[2'-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9'-spirobi[fluorene]-2-yl]-1-ethyl-8-methoxyquinolin-1-ium |
| SMILES | CC[n+]1cccc2c(-c3ccc4c(c3)C3(c5ccccc5-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc53)c3ccccc3-4)ccc(OC)c21 |
| InChI | InChI=1S/C52H37N4O/c1-3-56-30-14-21-42-37(28-29-47(57-2)48(42)56)35-24-26-40-38-19-10-12-22-43(38)52(45(40)31-35)44-23-13-11-20-39(44)41-27-25-36(32-46(41)52)51-54-49(33-15-6-4-7-16-33)53-50(55-51)34-17-8-5-9-18-34/h4-32H,3H2,1-2H3/q+1 |
| InChIKey | XDTGNKYZGALCMJ-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 51.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.90 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|