C25H32N6O5 — CID 123946551
N-[2-[[1-methyl-2-oxo-3-(3,4,5-trimethoxyphenyl)-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide (PubChem CID 123946551) has the molecular formula C25H32N6O5 and a molecular weight of 496.57 g/mol. Its IUPAC name is N-[2-[[1-methyl-2-oxo-3-(3,4,5-trimethoxyphenyl)-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | N-[2-[[1-methyl-2-oxo-3-(3,4,5-trimethoxyphenyl)-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 123946551 |
| Molecular Formula | C25H32N6O5 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | N-[2-[[1-methyl-2-oxo-3-(3,4,5-trimethoxyphenyl)-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCCCC1Nc1ncc2c(n1)N(C)C(=O)N(c1cc(OC)c(OC)c(OC)c1)C2 |
| InChI | InChI=1S/C25H32N6O5/c1-6-21(32)27-17-9-7-8-10-18(17)28-24-26-13-15-14-31(25(33)30(2)23(15)29-24)16-11-19(34-3)22(36-5)20(12-16)35-4/h6,11-13,17-18H,1,7-10,14H2,2-5H3,(H,27,32)(H,26,28,29) |
| InChIKey | GADRXBFODZQZTI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|