C14H21ClN4O3 — CID 123948564
methyl 4-(2-chloro-6,7,8,10,11,12-hexahydropyrimido[4,5-e][1,4,7]oxadiazecin-5-yl)butanoate (PubChem CID 123948564) has the molecular formula C14H21ClN4O3 and a molecular weight of 328.80 g/mol. Its IUPAC name is methyl 4-(2-chloro-6,7,8,10,11,12-hexahydropyrimido[4,5-e][1,4,7]oxadiazecin-5-yl)butanoate.
| Compound Name | methyl 4-(2-chloro-6,7,8,10,11,12-hexahydropyrimido[4,5-e][1,4,7]oxadiazecin-5-yl)butanoate |
|---|---|
| PubChem CID | 123948564 |
| Molecular Formula | C14H21ClN4O3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | methyl 4-(2-chloro-6,7,8,10,11,12-hexahydropyrimido[4,5-e][1,4,7]oxadiazecin-5-yl)butanoate |
| SMILES | COC(=O)CCCN1CCCOCCNc2nc(Cl)ncc21 |
| InChI | InChI=1S/C14H21ClN4O3/c1-21-12(20)4-2-6-19-7-3-8-22-9-5-16-13-11(19)10-17-14(15)18-13/h10H,2-9H2,1H3,(H,16,17,18) |
| InChIKey | KSBFKKWZYPNYLN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |