C10H13ClF2N4O2 — CID 123707786
2-chloro-5-(2,2-difluoroethyl)-7,8,10,11-tetrahydro-6H-pyrimido[4,5-d][1,3,6]oxadiazonin-6-ol (PubChem CID 123707786) has the molecular formula C10H13ClF2N4O2 and a molecular weight of 294.69 g/mol. Its IUPAC name is 2-chloro-5-(2,2-difluoroethyl)-7,8,10,11-tetrahydro-6H-pyrimido[4,5-d][1,3,6]oxadiazonin-6-ol.
| Compound Name | 2-chloro-5-(2,2-difluoroethyl)-7,8,10,11-tetrahydro-6H-pyrimido[4,5-d][1,3,6]oxadiazonin-6-ol |
|---|---|
| PubChem CID | 123707786 |
| Molecular Formula | C10H13ClF2N4O2 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-chloro-5-(2,2-difluoroethyl)-7,8,10,11-tetrahydro-6H-pyrimido[4,5-d][1,3,6]oxadiazonin-6-ol |
| SMILES | OC1CCOCNc2nc(Cl)ncc2N1CC(F)F |
| InChI | InChI=1S/C10H13ClF2N4O2/c11-10-14-3-6-9(16-10)15-5-19-2-1-8(18)17(6)4-7(12)13/h3,7-8,18H,1-2,4-5H2,(H,14,15,16) |
| InChIKey | FLHNNABAUPDJKD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |