C44H44F2N4O6 — CID 123951779
bis[3-[4-(5-fluoropyridine-3-carbonyl)piperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl] oxalate (PubChem CID 123951779) has the molecular formula C44H44F2N4O6 and a molecular weight of 762.85 g/mol. Its IUPAC name is bis[3-[4-(5-fluoropyridine-3-carbonyl)piperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl] oxalate.
| Compound Name | bis[3-[4-(5-fluoropyridine-3-carbonyl)piperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl] oxalate |
|---|---|
| PubChem CID | 123951779 |
| Molecular Formula | C44H44F2N4O6 |
| Molecular Weight | 762.85 g/mol |
| Exact Mass | 762.32 |
| IUPAC Name | bis[3-[4-(5-fluoropyridine-3-carbonyl)piperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl] oxalate |
| SMILES | O=C(OC1Cc2ccccc2CC1N1CCC(C(=O)c2cncc(F)c2)CC1)C(=O)OC1Cc2ccccc2CC1N1CCC(C(=O)c2cncc(F)c2)CC1 |
| InChI | InChI=1S/C44H44F2N4O6/c45-35-17-33(23-47-25-35)41(51)27-9-13-49(14-10-27)37-19-29-5-1-3-7-31(29)21-39(37)55-43(53)44(54)56-40-22-32-8-4-2-6-30(32)20-38(40)50-15-11-28(12-16-50)42(52)34-18-36(46)26-48-24-34/h1-8,17-18,23-28,37-40H,9-16,19-22H2 |
| InChIKey | XYQUFIKGOQWYGT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 119.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.85 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|