C25H28FN3O7 — CID 158931644
1,2-dihydroperoxyethyne;(4-fluorophenyl)-[1-[4-hydroxy-1-(pyridine-3-carbonyl)piperidin-3-yl]piperidin-4-yl]methanone (PubChem CID 158931644) has the molecular formula C25H28FN3O7 and a molecular weight of 501.51 g/mol. Its IUPAC name is 1,2-dihydroperoxyethyne;(4-fluorophenyl)-[1-[4-hydroxy-1-(pyridine-3-carbonyl)piperidin-3-yl]piperidin-4-yl]methanone.
| Compound Name | 1,2-dihydroperoxyethyne;(4-fluorophenyl)-[1-[4-hydroxy-1-(pyridine-3-carbonyl)piperidin-3-yl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 158931644 |
| Molecular Formula | C25H28FN3O7 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 1,2-dihydroperoxyethyne;(4-fluorophenyl)-[1-[4-hydroxy-1-(pyridine-3-carbonyl)piperidin-3-yl]piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(C2CN(C(=O)c3cccnc3)CCC2O)CC1.OOC#COO |
| InChI | InChI=1S/C23H26FN3O3.C2H2O4/c24-19-5-3-16(4-6-19)22(29)17-7-11-26(12-8-17)20-15-27(13-9-21(20)28)23(30)18-2-1-10-25-14-18;3-5-1-2-6-4/h1-6,10,14,17,20-21,28H,7-9,11-13,15H2;3-4H |
| InChIKey | JJDFUBWBARUXAV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 132.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|