C24H27FN2O3 — CID 67993225
[1-(1-benzoyl-3-hydroxypiperidin-4-yl)piperidin-4-yl]-(4-fluorophenyl)methanone (PubChem CID 67993225) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is [1-(1-benzoyl-3-hydroxypiperidin-4-yl)piperidin-4-yl]-(4-fluorophenyl)methanone.
| Compound Name | [1-(1-benzoyl-3-hydroxypiperidin-4-yl)piperidin-4-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 67993225 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | [1-(1-benzoyl-3-hydroxypiperidin-4-yl)piperidin-4-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(C2CCN(C(=O)c3ccccc3)CC2O)CC1 |
| InChI | InChI=1S/C24H27FN2O3/c25-20-8-6-17(7-9-20)23(29)18-10-13-26(14-11-18)21-12-15-27(16-22(21)28)24(30)19-4-2-1-3-5-19/h1-9,18,21-22,28H,10-16H2 |
| InChIKey | HZNXKDXDTGXESL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |