C26H28F2N2O7 — CID 53392069
[1-[(3S,4S)-1-(4-fluorobenzoyl)-3-hydroxypiperidin-4-yl]piperidin-4-yl]-(4-fluorophenyl)methanone;oxalic acid (PubChem CID 53392069) has the molecular formula C26H28F2N2O7 and a molecular weight of 518.51 g/mol. Its IUPAC name is [1-[(3S,4S)-1-(4-fluorobenzoyl)-3-hydroxypiperidin-4-yl]piperidin-4-yl]-(4-fluorophenyl)methanone;oxalic acid.
| Compound Name | [1-[(3S,4S)-1-(4-fluorobenzoyl)-3-hydroxypiperidin-4-yl]piperidin-4-yl]-(4-fluorophenyl)methanone;oxalic acid |
|---|---|
| PubChem CID | 53392069 |
| Molecular Formula | C26H28F2N2O7 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | [1-[(3S,4S)-1-(4-fluorobenzoyl)-3-hydroxypiperidin-4-yl]piperidin-4-yl]-(4-fluorophenyl)methanone;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(c1ccc(F)cc1)C1CCN([C@H]2CCN(C(=O)c3ccc(F)cc3)C[C@@H]2O)CC1 |
| InChI | InChI=1S/C24H26F2N2O3.C2H2O4/c25-19-5-1-16(2-6-19)23(30)17-9-12-27(13-10-17)21-11-14-28(15-22(21)29)24(31)18-3-7-20(26)8-4-18;3-1(4)2(5)6/h1-8,17,21-22,29H,9-15H2;(H,3,4)(H,5,6)/t21-,22-;/m0./s1 |
| InChIKey | VKRXCGDAHCFDAC-VROPFNGYSA-N |
| XLogP | 2.29 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|