C27H37FN2O2Si — CID 67993156
[1-[3-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-4-yl]-(6-fluoro-3-pyridinyl)methanone (PubChem CID 67993156) has the molecular formula C27H37FN2O2Si and a molecular weight of 468.69 g/mol. Its IUPAC name is [1-[3-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-4-yl]-(6-fluoro-3-pyridinyl)methanone.
| Compound Name | [1-[3-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-4-yl]-(6-fluoro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 67993156 |
| Molecular Formula | C27H37FN2O2Si |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | [1-[3-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-4-yl]-(6-fluoro-3-pyridinyl)methanone |
| SMILES | CC(C)(C)[Si](C)(C)OC1Cc2ccccc2CC1N1CCC(C(=O)c2ccc(F)nc2)CC1 |
| InChI | InChI=1S/C27H37FN2O2Si/c1-27(2,3)33(4,5)32-24-17-21-9-7-6-8-20(21)16-23(24)30-14-12-19(13-15-30)26(31)22-10-11-25(28)29-18-22/h6-11,18-19,23-24H,12-17H2,1-5H3 |
| InChIKey | CRSBNFADUYXOHW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|