C24H39FN2O4Si — CID 175910158
tert-butyl N-[(1R,2R,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-(6-fluoropyridine-3-carbonyl)cyclohexyl]-N-methylcarbamate (PubChem CID 175910158) has the molecular formula C24H39FN2O4Si and a molecular weight of 466.67 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-(6-fluoropyridine-3-carbonyl)cyclohexyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1R,2R,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-(6-fluoropyridine-3-carbonyl)cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 175910158 |
| Molecular Formula | C24H39FN2O4Si |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | tert-butyl N-[(1R,2R,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-(6-fluoropyridine-3-carbonyl)cyclohexyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H]1CC[C@H](C(=O)c2ccc(F)nc2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H39FN2O4Si/c1-23(2,3)30-22(29)27(7)18-12-10-16(21(28)17-11-13-20(25)26-15-17)14-19(18)31-32(8,9)24(4,5)6/h11,13,15-16,18-19H,10,12,14H2,1-9H3/t16-,18+,19+/m0/s1 |
| InChIKey | XYQBYOJMGILKGL-QXAKKESOSA-N |
| XLogP | 5.83 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|