C21H32FN3O4 — CID 168962634
tert-butyl N-[4-[3-fluoro-1-(oxan-2-yl)pyrazole-5-carbonyl]cyclohexyl]-N-methylcarbamate (PubChem CID 168962634) has the molecular formula C21H32FN3O4 and a molecular weight of 409.50 g/mol. Its IUPAC name is tert-butyl N-[4-[3-fluoro-1-(oxan-2-yl)pyrazole-5-carbonyl]cyclohexyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[3-fluoro-1-(oxan-2-yl)pyrazole-5-carbonyl]cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 168962634 |
| Molecular Formula | C21H32FN3O4 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | tert-butyl N-[4-[3-fluoro-1-(oxan-2-yl)pyrazole-5-carbonyl]cyclohexyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCC(C(=O)c2cc(F)nn2C2CCCCO2)CC1 |
| InChI | InChI=1S/C21H32FN3O4/c1-21(2,3)29-20(27)24(4)15-10-8-14(9-11-15)19(26)16-13-17(22)23-25(16)18-7-5-6-12-28-18/h13-15,18H,5-12H2,1-4H3 |
| InChIKey | HVNHMKAJTJRJBX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |