C16H26N2O4 — CID 155430804
ethyl 3-[(2-methylpropan-2-yl)oxymethyl]-1-(oxan-2-yl)pyrazole-5-carboxylate (PubChem CID 155430804) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is ethyl 3-[(2-methylpropan-2-yl)oxymethyl]-1-(oxan-2-yl)pyrazole-5-carboxylate.
| Compound Name | ethyl 3-[(2-methylpropan-2-yl)oxymethyl]-1-(oxan-2-yl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 155430804 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | ethyl 3-[(2-methylpropan-2-yl)oxymethyl]-1-(oxan-2-yl)pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(COC(C)(C)C)nn1C1CCCCO1 |
| InChI | InChI=1S/C16H26N2O4/c1-5-20-15(19)13-10-12(11-22-16(2,3)4)17-18(13)14-8-6-7-9-21-14/h10,14H,5-9,11H2,1-4H3 |
| InChIKey | NHFXBDVHNZWPPI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |