C25H42N2O4Si — CID 175910130
tert-butyl N-[(1R,2R,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]cyclohexyl]-N-methylcarbamate (PubChem CID 175910130) has the molecular formula C25H42N2O4Si and a molecular weight of 462.71 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]cyclohexyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1R,2R,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 175910130 |
| Molecular Formula | C25H42N2O4Si |
| Molecular Weight | 462.71 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | tert-butyl N-[(1R,2R,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]cyclohexyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H]1CC[C@H](/C(=N/O)c2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42N2O4Si/c1-24(2,3)30-23(28)27(7)20-16-15-19(22(26-29)18-13-11-10-12-14-18)17-21(20)31-32(8,9)25(4,5)6/h10-14,19-21,29H,15-17H2,1-9H3/b26-22+/t19-,20+,21+/m0/s1 |
| InChIKey | QGOUGDZECSGVCH-NGJKUJNZSA-N |
| XLogP | 6.29 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.71 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|