C29H51N — CID 123954394
(6E)-6-butan-2-ylidene-3,9-diethyl-8-(2-ethylbut-2-enyl)-11-methyltetradeca-3,11-dien-7-imine (PubChem CID 123954394) has the molecular formula C29H51N and a molecular weight of 413.73 g/mol. Its IUPAC name is (6E)-6-butan-2-ylidene-3,9-diethyl-8-(2-ethylbut-2-enyl)-11-methyltetradeca-3,11-dien-7-imine.
| Compound Name | (6E)-6-butan-2-ylidene-3,9-diethyl-8-(2-ethylbut-2-enyl)-11-methyltetradeca-3,11-dien-7-imine |
|---|---|
| PubChem CID | 123954394 |
| Molecular Formula | C29H51N |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 413.40 |
| IUPAC Name | (6E)-6-butan-2-ylidene-3,9-diethyl-8-(2-ethylbut-2-enyl)-11-methyltetradeca-3,11-dien-7-imine |
| SMILES | [H]/N=C(C(\CC=C(CC)CC)=C(/C)CC)/C(CC(=CC)CC)C(CC)CC(C)=CCC |
| InChI | InChI=1S/C29H51N/c1-10-17-22(8)20-26(16-7)28(21-25(14-5)15-6)29(30)27(23(9)11-2)19-18-24(12-3)13-4/h14,17-18,26,28,30H,10-13,15-16,19-21H2,1-9H3/b22-17?,25-14?,27-23+,30-29+ |
| InChIKey | MMFRRBSQBZDXHS-KWMBAUCCSA-N |
| XLogP | 10.00 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|