C19H34O5Si — CID 123955246
triethoxy-[3-[4-(1-ethoxyethoxy)phenyl]propyl]silane (PubChem CID 123955246) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is triethoxy-[3-[4-(1-ethoxyethoxy)phenyl]propyl]silane.
| Compound Name | triethoxy-[3-[4-(1-ethoxyethoxy)phenyl]propyl]silane |
|---|---|
| PubChem CID | 123955246 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | triethoxy-[3-[4-(1-ethoxyethoxy)phenyl]propyl]silane |
| SMILES | CCOC(C)Oc1ccc(CCC[Si](OCC)(OCC)OCC)cc1 |
| InChI | InChI=1S/C19H34O5Si/c1-6-20-17(5)24-19-14-12-18(13-15-19)11-10-16-25(21-7-2,22-8-3)23-9-4/h12-15,17H,6-11,16H2,1-5H3 |
| InChIKey | SSWLCJHKNLUQIA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|