C8H14N2 — CID 123957660
N'-ethenyl-2,3-dimethylbut-2-enimidamide (PubChem CID 123957660) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N'-ethenyl-2,3-dimethylbut-2-enimidamide.
| Compound Name | N'-ethenyl-2,3-dimethylbut-2-enimidamide |
|---|---|
| PubChem CID | 123957660 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N'-ethenyl-2,3-dimethylbut-2-enimidamide |
| SMILES | C=C/N=C(\N)C(C)=C(C)C |
| InChI | InChI=1S/C8H14N2/c1-5-10-8(9)7(4)6(2)3/h5H,1H2,2-4H3,(H2,9,10) |
| InChIKey | OCJYCBYDIBANLF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|