C20H24ClF2N5O2 — CID 123958714
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4-[2-(2,2-difluorocyclopropyl)ethoxyimino]-N-ethyl-2-methylbutanamide (PubChem CID 123958714) has the molecular formula C20H24ClF2N5O2 and a molecular weight of 439.89 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4-[2-(2,2-difluorocyclopropyl)ethoxyimino]-N-ethyl-2-methylbutanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4-[2-(2,2-difluorocyclopropyl)ethoxyimino]-N-ethyl-2-methylbutanamide |
|---|---|
| PubChem CID | 123958714 |
| Molecular Formula | C20H24ClF2N5O2 |
| Molecular Weight | 439.89 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4-[2-(2,2-difluorocyclopropyl)ethoxyimino]-N-ethyl-2-methylbutanamide |
| SMILES | CCN(C(=O)C(C)CC=NOCCC1CC1(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C20H24ClF2N5O2/c1-3-27(17-13-28(26-18(17)21)16-5-4-8-24-12-16)19(29)14(2)6-9-25-30-10-7-15-11-20(15,22)23/h4-5,8-9,12-15H,3,6-7,10-11H2,1-2H3 |
| InChIKey | OKCYOOCZTNVSRK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.89 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|