C17H22ClN5O2S — CID 118023858
S-[1-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-2-methyl-1-oxopentan-3-yl] carbamothioate (PubChem CID 118023858) has the molecular formula C17H22ClN5O2S and a molecular weight of 395.92 g/mol. Its IUPAC name is S-[1-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-2-methyl-1-oxopentan-3-yl] carbamothioate.
| Compound Name | S-[1-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-2-methyl-1-oxopentan-3-yl] carbamothioate |
|---|---|
| PubChem CID | 118023858 |
| Molecular Formula | C17H22ClN5O2S |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | S-[1-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-2-methyl-1-oxopentan-3-yl] carbamothioate |
| SMILES | CCC(SC(N)=O)C(C)C(=O)N(CC)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C17H22ClN5O2S/c1-4-14(26-17(19)25)11(3)16(24)22(5-2)13-10-23(21-15(13)18)12-7-6-8-20-9-12/h6-11,14H,4-5H2,1-3H3,(H2,19,25) |
| InChIKey | TUVYWXFMQHXNLD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|