C14H22O3Si — CID 123960079
1-[4-[[methoxy(methyl)silyl]methoxy]phenyl]-2,2-dimethylpropan-1-one (PubChem CID 123960079) has the molecular formula C14H22O3Si and a molecular weight of 266.41 g/mol. Its IUPAC name is 1-[4-[[methoxy(methyl)silyl]methoxy]phenyl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-[[methoxy(methyl)silyl]methoxy]phenyl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 123960079 |
| Molecular Formula | C14H22O3Si |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-[4-[[methoxy(methyl)silyl]methoxy]phenyl]-2,2-dimethylpropan-1-one |
| SMILES | CO[SiH](C)COc1ccc(C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H22O3Si/c1-14(2,3)13(15)11-6-8-12(9-7-11)17-10-18(5)16-4/h6-9,18H,10H2,1-5H3 |
| InChIKey | CFAALHYNKGHFOK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|