C15H25NO7S — CID 123965222
[4-[1-[2-(2-methoxyethoxy)ethoxy]ethoxy]-6-methyl-2-pyridinyl]methyl methanesulfonate (PubChem CID 123965222) has the molecular formula C15H25NO7S and a molecular weight of 363.43 g/mol. Its IUPAC name is [4-[1-[2-(2-methoxyethoxy)ethoxy]ethoxy]-6-methyl-2-pyridinyl]methyl methanesulfonate.
| Compound Name | [4-[1-[2-(2-methoxyethoxy)ethoxy]ethoxy]-6-methyl-2-pyridinyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 123965222 |
| Molecular Formula | C15H25NO7S |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | [4-[1-[2-(2-methoxyethoxy)ethoxy]ethoxy]-6-methyl-2-pyridinyl]methyl methanesulfonate |
| SMILES | COCCOCCOC(C)Oc1cc(C)nc(COS(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H25NO7S/c1-12-9-15(10-14(16-12)11-22-24(4,17)18)23-13(2)21-8-7-20-6-5-19-3/h9-10,13H,5-8,11H2,1-4H3 |
| InChIKey | LAOIBPRSMLNJMU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|