C23H31NO9S — CID 154596901
methyl 4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-methylphenyl]-6-(methylsulfonyloxymethyl)pyridine-2-carboxylate (PubChem CID 154596901) has the molecular formula C23H31NO9S and a molecular weight of 497.57 g/mol. Its IUPAC name is methyl 4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-methylphenyl]-6-(methylsulfonyloxymethyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-methylphenyl]-6-(methylsulfonyloxymethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 154596901 |
| Molecular Formula | C23H31NO9S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | methyl 4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-methylphenyl]-6-(methylsulfonyloxymethyl)pyridine-2-carboxylate |
| SMILES | COCCOCCOCCOc1ccc(-c2cc(COS(C)(=O)=O)nc(C(=O)OC)c2)c(C)c1 |
| InChI | InChI=1S/C23H31NO9S/c1-17-13-20(32-12-11-31-10-9-30-8-7-28-2)5-6-21(17)18-14-19(16-33-34(4,26)27)24-22(15-18)23(25)29-3/h5-6,13-15H,7-12,16H2,1-4H3 |
| InChIKey | CMFWCAVFKNLRBO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 119.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|