C25H30N2O8S — CID 90296728
methyl 4-[2-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]phenyl]ethynyl]-6-(methylsulfonyloxymethyl)pyridine-2-carboxylate (PubChem CID 90296728) has the molecular formula C25H30N2O8S and a molecular weight of 518.59 g/mol. Its IUPAC name is methyl 4-[2-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]phenyl]ethynyl]-6-(methylsulfonyloxymethyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-[2-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]phenyl]ethynyl]-6-(methylsulfonyloxymethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90296728 |
| Molecular Formula | C25H30N2O8S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | methyl 4-[2-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]phenyl]ethynyl]-6-(methylsulfonyloxymethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(C#Cc2ccc(OCCCNC(=O)OC(C)(C)C)cc2)cc(COS(C)(=O)=O)n1 |
| InChI | InChI=1S/C25H30N2O8S/c1-25(2,3)35-24(29)26-13-6-14-33-21-11-9-18(10-12-21)7-8-19-15-20(17-34-36(5,30)31)27-22(16-19)23(28)32-4/h9-12,15-16H,6,13-14,17H2,1-5H3,(H,26,29) |
| InChIKey | LYCJCQUJGWBAEC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 130.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|