C16H15NO5S — CID 137402900
dimethyl 4-(2-methyl-4-sulfanyloxyphenyl)pyridine-2,6-dicarboxylate (PubChem CID 137402900) has the molecular formula C16H15NO5S and a molecular weight of 333.37 g/mol. Its IUPAC name is dimethyl 4-(2-methyl-4-sulfanyloxyphenyl)pyridine-2,6-dicarboxylate.
| Compound Name | dimethyl 4-(2-methyl-4-sulfanyloxyphenyl)pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 137402900 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | dimethyl 4-(2-methyl-4-sulfanyloxyphenyl)pyridine-2,6-dicarboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(OS)cc2C)cc(C(=O)OC)n1 |
| InChI | InChI=1S/C16H15NO5S/c1-9-6-11(22-23)4-5-12(9)10-7-13(15(18)20-2)17-14(8-10)16(19)21-3/h4-8,23H,1-3H3 |
| InChIKey | QQGYIWQHPHJNIS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 74.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|