C16H14N2O5S — CID 137402319
dimethyl 4-(4-formamido-2-sulfanylphenyl)pyridine-2,6-dicarboxylate (PubChem CID 137402319) has the molecular formula C16H14N2O5S and a molecular weight of 346.36 g/mol. Its IUPAC name is dimethyl 4-(4-formamido-2-sulfanylphenyl)pyridine-2,6-dicarboxylate.
| Compound Name | dimethyl 4-(4-formamido-2-sulfanylphenyl)pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 137402319 |
| Molecular Formula | C16H14N2O5S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | dimethyl 4-(4-formamido-2-sulfanylphenyl)pyridine-2,6-dicarboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(NC=O)cc2S)cc(C(=O)OC)n1 |
| InChI | InChI=1S/C16H14N2O5S/c1-22-15(20)12-5-9(6-13(18-12)16(21)23-2)11-4-3-10(17-8-19)7-14(11)24/h3-8,24H,1-2H3,(H,17,19) |
| InChIKey | DXMJTBRPRDSFPQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|