C16H26O7S — CID 171617041
1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 171617041) has the molecular formula C16H26O7S and a molecular weight of 362.44 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171617041 |
| Molecular Formula | C16H26O7S |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | COCCOCCOCCOC(C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H26O7S/c1-14-4-6-16(7-5-14)24(17,18)23-15(2)22-13-12-21-11-10-20-9-8-19-3/h4-7,15H,8-13H2,1-3H3 |
| InChIKey | HGVBCPZPSGWQBR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|