C11H17NO4S — CID 59366827
[(1S)-2-methoxy-1-(methylamino)ethyl] 4-methylbenzenesulfonate (PubChem CID 59366827) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is [(1S)-2-methoxy-1-(methylamino)ethyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S)-2-methoxy-1-(methylamino)ethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59366827 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | [(1S)-2-methoxy-1-(methylamino)ethyl] 4-methylbenzenesulfonate |
| SMILES | CN[C@H](COC)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H17NO4S/c1-9-4-6-10(7-5-9)17(13,14)16-11(12-2)8-15-3/h4-7,11-12H,8H2,1-3H3/t11-/m0/s1 |
| InChIKey | ZKXQSEZWBJAFHT-NSHDSACASA-N |
| XLogP | 0.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|