C19H22F6N4O — CID 123967756
3-amino-1-[3-ethylimino-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 123967756) has the molecular formula C19H22F6N4O and a molecular weight of 436.40 g/mol. Its IUPAC name is 3-amino-1-[3-ethylimino-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 3-amino-1-[3-ethylimino-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 123967756 |
| Molecular Formula | C19H22F6N4O |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 3-amino-1-[3-ethylimino-4-(3,3,3-trifluoroprop-1-en-2-yl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | C=C(N1CCN(C(=O)CC(N)Cc2cc(F)c(F)cc2F)C/C1=N\CC)C(F)(F)F |
| InChI | InChI=1S/C19H22F6N4O/c1-3-27-17-10-28(4-5-29(17)11(2)19(23,24)25)18(30)8-13(26)6-12-7-15(21)16(22)9-14(12)20/h7,9,13H,2-6,8,10,26H2,1H3/b27-17+ |
| InChIKey | IHMGIGFFHMNQBK-WPWMEQJKSA-N |
| XLogP | 3.00 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|