C27H25N7O2 — CID 123968262
2-cyano-N'-[1-[5-(2-methoxypyrimidin-5-yl)-4-oxo-3-phenylquinazolin-2-yl]ethyl]-N-methylidenebutanimidamide (PubChem CID 123968262) has the molecular formula C27H25N7O2 and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-cyano-N'-[1-[5-(2-methoxypyrimidin-5-yl)-4-oxo-3-phenylquinazolin-2-yl]ethyl]-N-methylidenebutanimidamide.
| Compound Name | 2-cyano-N'-[1-[5-(2-methoxypyrimidin-5-yl)-4-oxo-3-phenylquinazolin-2-yl]ethyl]-N-methylidenebutanimidamide |
|---|---|
| PubChem CID | 123968262 |
| Molecular Formula | C27H25N7O2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 2-cyano-N'-[1-[5-(2-methoxypyrimidin-5-yl)-4-oxo-3-phenylquinazolin-2-yl]ethyl]-N-methylidenebutanimidamide |
| SMILES | C=N/C(=N\C(C)c1nc2cccc(-c3cnc(OC)nc3)c2c(=O)n1-c1ccccc1)C(C#N)CC |
| InChI | InChI=1S/C27H25N7O2/c1-5-18(14-28)24(29-3)32-17(2)25-33-22-13-9-12-21(19-15-30-27(36-4)31-16-19)23(22)26(35)34(25)20-10-7-6-8-11-20/h6-13,15-18H,3,5H2,1-2,4H3/b32-24- |
| InChIKey | ORHPDOOKRIBRSY-TZHWMEPESA-N |
| XLogP | 4.56 |
| TPSA | 118.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|